C10H20N2S — CID 143524005
(2S)-1-amino-5-[[(3Z)-penta-1,3-dien-2-yl]amino]pentane-2-thiol (PubChem CID 143524005) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is (2S)-1-amino-5-[[(3Z)-penta-1,3-dien-2-yl]amino]pentane-2-thiol.
| Compound Name | (2S)-1-amino-5-[[(3Z)-penta-1,3-dien-2-yl]amino]pentane-2-thiol |
|---|---|
| PubChem CID | 143524005 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (2S)-1-amino-5-[[(3Z)-penta-1,3-dien-2-yl]amino]pentane-2-thiol |
| SMILES | C=C(/C=C\C)NCCC[C@H](S)CN |
| InChI | InChI=1S/C10H20N2S/c1-3-5-9(2)12-7-4-6-10(13)8-11/h3,5,10,12-13H,2,4,6-8,11H2,1H3/b5-3-/t10-/m0/s1 |
| InChIKey | UAIRZYIQVIBYRE-ATPLWMGHSA-N |
| XLogP | 1.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|