C13H14ClF3N2O3 — CID 143527563
N-[4-chloro-3-(trifluoromethyl)phenyl]-N-(2-hydroxyethylcarbamoyl)propanamide (PubChem CID 143527563) has the molecular formula C13H14ClF3N2O3 and a molecular weight of 338.71 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N-(2-hydroxyethylcarbamoyl)propanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N-(2-hydroxyethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 143527563 |
| Molecular Formula | C13H14ClF3N2O3 |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N-(2-hydroxyethylcarbamoyl)propanamide |
| SMILES | CCC(=O)N(C(=O)NCCO)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14ClF3N2O3/c1-2-11(21)19(12(22)18-5-6-20)8-3-4-10(14)9(7-8)13(15,16)17/h3-4,7,20H,2,5-6H2,1H3,(H,18,22) |
| InChIKey | BNDXWFXDUFAFFE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |