C10H14N2O — CID 143559789
(1Z,3Z)-3-ethenyl-1-[(Z)-ethylideneamino]-2-(methylideneamino)penta-1,3-dien-1-ol (PubChem CID 143559789) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (1Z,3Z)-3-ethenyl-1-[(Z)-ethylideneamino]-2-(methylideneamino)penta-1,3-dien-1-ol.
| Compound Name | (1Z,3Z)-3-ethenyl-1-[(Z)-ethylideneamino]-2-(methylideneamino)penta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 143559789 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (1Z,3Z)-3-ethenyl-1-[(Z)-ethylideneamino]-2-(methylideneamino)penta-1,3-dien-1-ol |
| SMILES | C=C/C(=C/C)C(N=C)=C(O)/N=C\C |
| InChI | InChI=1S/C10H14N2O/c1-5-8(6-2)9(11-4)10(13)12-7-3/h5-7,13H,1,4H2,2-3H3/b8-6-,10-9-,12-7- |
| InChIKey | KSFIHBMTAFXTIS-BZJSTAESSA-N |
| XLogP | 2.64 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|