C10H11BrN2 — CID 143569776
6-bromo-8-methyl-2,3-dihydroisoquinolin-3-amine (PubChem CID 143569776) has the molecular formula C10H11BrN2 and a molecular weight of 239.12 g/mol. Its IUPAC name is 6-bromo-8-methyl-2,3-dihydroisoquinolin-3-amine.
| Compound Name | 6-bromo-8-methyl-2,3-dihydroisoquinolin-3-amine |
|---|---|
| PubChem CID | 143569776 |
| Molecular Formula | C10H11BrN2 |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 6-bromo-8-methyl-2,3-dihydroisoquinolin-3-amine |
| SMILES | Cc1cc(Br)cc2c1=CNC(N)C=2 |
| InChI | InChI=1S/C10H11BrN2/c1-6-2-8(11)3-7-4-10(12)13-5-9(6)7/h2-5,10,13H,12H2,1H3 |
| InChIKey | KBGSKIOLEQRSJQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |