C12H9F5 — CID 143571821
1-methyl-3-(2,3,4,5,6-pentafluorophenyl)bicyclo[1.1.1]pentane (PubChem CID 143571821) has the molecular formula C12H9F5 and a molecular weight of 248.19 g/mol. Its IUPAC name is 1-methyl-3-(2,3,4,5,6-pentafluorophenyl)bicyclo[1.1.1]pentane.
| Compound Name | 1-methyl-3-(2,3,4,5,6-pentafluorophenyl)bicyclo[1.1.1]pentane |
|---|---|
| PubChem CID | 143571821 |
| Molecular Formula | C12H9F5 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 1-methyl-3-(2,3,4,5,6-pentafluorophenyl)bicyclo[1.1.1]pentane |
| SMILES | CC12CC(c3c(F)c(F)c(F)c(F)c3F)(C1)C2 |
| InChI | InChI=1S/C12H9F5/c1-11-2-12(3-11,4-11)5-6(13)8(15)10(17)9(16)7(5)14/h2-4H2,1H3 |
| InChIKey | VCHQPMBFXQJWOC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|