C14H27N3 — CID 143585667
(3Z)-5-N-[2-[tert-butyl(methyl)amino]ethyl]-5-N-methylhexa-1,3,5-triene-2,5-diamine (PubChem CID 143585667) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is (3Z)-5-N-[2-[tert-butyl(methyl)amino]ethyl]-5-N-methylhexa-1,3,5-triene-2,5-diamine.
| Compound Name | (3Z)-5-N-[2-[tert-butyl(methyl)amino]ethyl]-5-N-methylhexa-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 143585667 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (3Z)-5-N-[2-[tert-butyl(methyl)amino]ethyl]-5-N-methylhexa-1,3,5-triene-2,5-diamine |
| SMILES | C=C(N)/C=C\C(=C)N(C)CCN(C)C(C)(C)C |
| InChI | InChI=1S/C14H27N3/c1-12(15)8-9-13(2)16(6)10-11-17(7)14(3,4)5/h8-9H,1-2,10-11,15H2,3-7H3/b9-8- |
| InChIKey | QGYRYRBQUAUWHP-HJWRWDBZSA-N |
| XLogP | 2.19 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|