C17H11IO4S3 — CID 143612232
[4-(5-sulfanylidenedithiol-3-yl)phenyl] 4-acetyloxy-1λ3-iodacyclohexa-1,3,5-triene-3-carboxylate (PubChem CID 143612232) has the molecular formula C17H11IO4S3 and a molecular weight of 502.38 g/mol. Its IUPAC name is [4-(5-sulfanylidenedithiol-3-yl)phenyl] 4-acetyloxy-1λ3-iodacyclohexa-1,3,5-triene-3-carboxylate.
| Compound Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 4-acetyloxy-1λ3-iodacyclohexa-1,3,5-triene-3-carboxylate |
|---|---|
| PubChem CID | 143612232 |
| Molecular Formula | C17H11IO4S3 |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 501.89 |
| IUPAC Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 4-acetyloxy-1λ3-iodacyclohexa-1,3,5-triene-3-carboxylate |
| SMILES | CC(=O)OC1=C(C(=O)Oc2ccc(-c3cc(=S)ss3)cc2)C=IC=C1 |
| InChI | InChI=1S/C17H11IO4S3/c1-10(19)21-14-6-7-18-9-13(14)17(20)22-12-4-2-11(3-5-12)15-8-16(23)25-24-15/h2-9H,1H3 |
| InChIKey | FUPGERIMXQJEAR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|