C9H20BNS — CID 143641729
(1,6,6-trimethylazepan-4-yl)borinothioic acid (PubChem CID 143641729) has the molecular formula C9H20BNS and a molecular weight of 185.15 g/mol. Its IUPAC name is (1,6,6-trimethylazepan-4-yl)borinothioic acid.
| Compound Name | (1,6,6-trimethylazepan-4-yl)borinothioic acid |
|---|---|
| PubChem CID | 143641729 |
| Molecular Formula | C9H20BNS |
| Molecular Weight | 185.15 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (1,6,6-trimethylazepan-4-yl)borinothioic acid |
| SMILES | CN1CCC(BS)CC(C)(C)C1 |
| InChI | InChI=1S/C9H20BNS/c1-9(2)6-8(10-12)4-5-11(3)7-9/h8,10,12H,4-7H2,1-3H3 |
| InChIKey | AIWGBXUSIXVHAI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.15 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|