C19H27F3N6O — CID 143789877
N-[[1-(methylamino)ethenylamino]-[3-(trifluoromethyl)anilino]methylidene]-N'-(2-morpholin-4-ylethyl)ethanimidamide (PubChem CID 143789877) has the molecular formula C19H27F3N6O and a molecular weight of 412.46 g/mol. Its IUPAC name is N-[[1-(methylamino)ethenylamino]-[3-(trifluoromethyl)anilino]methylidene]-N'-(2-morpholin-4-ylethyl)ethanimidamide.
| Compound Name | N-[[1-(methylamino)ethenylamino]-[3-(trifluoromethyl)anilino]methylidene]-N'-(2-morpholin-4-ylethyl)ethanimidamide |
|---|---|
| PubChem CID | 143789877 |
| Molecular Formula | C19H27F3N6O |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-[[1-(methylamino)ethenylamino]-[3-(trifluoromethyl)anilino]methylidene]-N'-(2-morpholin-4-ylethyl)ethanimidamide |
| SMILES | C=C(NC)N/C(=N\C(C)=N\CCN1CCOCC1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H27F3N6O/c1-14(23-3)25-18(27-17-6-4-5-16(13-17)19(20,21)22)26-15(2)24-7-8-28-9-11-29-12-10-28/h4-6,13,23H,1,7-12H2,2-3H3,(H2,24,25,26,27) |
| InChIKey | KVOVHISLGPDGIM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|