C14H10 — CID 143818345
1-(1-phenylethenyl)cyclohexa-1,3-dien-5-yne (PubChem CID 143818345) has the molecular formula C14H10 and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-(1-phenylethenyl)cyclohexa-1,3-dien-5-yne.
| Compound Name | 1-(1-phenylethenyl)cyclohexa-1,3-dien-5-yne |
|---|---|
| PubChem CID | 143818345 |
| Molecular Formula | C14H10 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 1-(1-phenylethenyl)cyclohexa-1,3-dien-5-yne |
| SMILES | C=C(c1c#cccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-6,8-10H,1H2 |
| InChIKey | PPBXSWLQPFXNHO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |