C12H13I2NO3S — CID 143820193
2-[[2-[(3,5-diiodophenyl)methyl]-3-sulfanylpropanoyl]amino]acetic acid (PubChem CID 143820193) has the molecular formula C12H13I2NO3S and a molecular weight of 505.12 g/mol. Its IUPAC name is 2-[[2-[(3,5-diiodophenyl)methyl]-3-sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[(3,5-diiodophenyl)methyl]-3-sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 143820193 |
| Molecular Formula | C12H13I2NO3S |
| Molecular Weight | 505.12 g/mol |
| Exact Mass | 504.87 |
| IUPAC Name | 2-[[2-[(3,5-diiodophenyl)methyl]-3-sulfanylpropanoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C(CS)Cc1cc(I)cc(I)c1 |
| InChI | InChI=1S/C12H13I2NO3S/c13-9-2-7(3-10(14)4-9)1-8(6-19)12(18)15-5-11(16)17/h2-4,8,19H,1,5-6H2,(H,15,18)(H,16,17) |
| InChIKey | DAESUOFKLJTRJO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.12 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|