C14H12F2N2S2 — CID 143826111
S-[2-[[(E)-2-(2,6-difluorophenyl)ethenyl]sulfanylamino]phenyl]thiohydroxylamine (PubChem CID 143826111) has the molecular formula C14H12F2N2S2 and a molecular weight of 310.39 g/mol. Its IUPAC name is S-[2-[[(E)-2-(2,6-difluorophenyl)ethenyl]sulfanylamino]phenyl]thiohydroxylamine.
| Compound Name | S-[2-[[(E)-2-(2,6-difluorophenyl)ethenyl]sulfanylamino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 143826111 |
| Molecular Formula | C14H12F2N2S2 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | S-[2-[[(E)-2-(2,6-difluorophenyl)ethenyl]sulfanylamino]phenyl]thiohydroxylamine |
| SMILES | NSc1ccccc1NS/C=C/c1c(F)cccc1F |
| InChI | InChI=1S/C14H12F2N2S2/c15-11-4-3-5-12(16)10(11)8-9-19-18-13-6-1-2-7-14(13)20-17/h1-9,18H,17H2/b9-8+ |
| InChIKey | HKTIMTFBXZGEGW-CMDGGOBGSA-N |
| XLogP | 4.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|