C14H11Cl3N2S2 — CID 143826097
S-[5-chloro-2-[[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfanylamino]phenyl]thiohydroxylamine (PubChem CID 143826097) has the molecular formula C14H11Cl3N2S2 and a molecular weight of 377.75 g/mol. Its IUPAC name is S-[5-chloro-2-[[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfanylamino]phenyl]thiohydroxylamine.
| Compound Name | S-[5-chloro-2-[[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfanylamino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 143826097 |
| Molecular Formula | C14H11Cl3N2S2 |
| Molecular Weight | 377.75 g/mol |
| Exact Mass | 375.94 |
| IUPAC Name | S-[5-chloro-2-[[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfanylamino]phenyl]thiohydroxylamine |
| SMILES | NSc1cc(Cl)ccc1NS/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl3N2S2/c15-10-2-4-13(14(8-10)21-18)19-20-6-5-9-1-3-11(16)12(17)7-9/h1-8,19H,18H2/b6-5+ |
| InChIKey | YAXRQJQNNJRUPG-AATRIKPKSA-N |
| XLogP | 6.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.75 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|