C7H7OS+ — CID 143851227
(4,5-dimethylthiophen-2-yl)methanone (PubChem CID 143851227) has the molecular formula C7H7OS+ and a molecular weight of 139.20 g/mol. Its IUPAC name is (4,5-dimethylthiophen-2-yl)methanone.
| Compound Name | (4,5-dimethylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 143851227 |
| Molecular Formula | C7H7OS+ |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.02 |
| IUPAC Name | (4,5-dimethylthiophen-2-yl)methanone |
| SMILES | Cc1cc([C+]=O)sc1C |
| InChI | InChI=1S/C7H7OS/c1-5-3-7(4-8)9-6(5)2/h3H,1-2H3/q+1 |
| InChIKey | QTWVGGZBJVTRMY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|