C11H18BrNO2 — CID 143897913
ethane;methyl N-[(3Z,5Z)-4-bromohepta-1,3,5-trien-3-yl]carbamate (PubChem CID 143897913) has the molecular formula C11H18BrNO2 and a molecular weight of 276.17 g/mol. Its IUPAC name is ethane;methyl N-[(3Z,5Z)-4-bromohepta-1,3,5-trien-3-yl]carbamate.
| Compound Name | ethane;methyl N-[(3Z,5Z)-4-bromohepta-1,3,5-trien-3-yl]carbamate |
|---|---|
| PubChem CID | 143897913 |
| Molecular Formula | C11H18BrNO2 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | ethane;methyl N-[(3Z,5Z)-4-bromohepta-1,3,5-trien-3-yl]carbamate |
| SMILES | C=C/C(NC(=O)OC)=C(Br)\C=C/C.CC |
| InChI | InChI=1S/C9H12BrNO2.C2H6/c1-4-6-7(10)8(5-2)11-9(12)13-3;1-2/h4-6H,2H2,1,3H3,(H,11,12);1-2H3/b6-4-,8-7-; |
| InChIKey | QGWVSMDCNDTOBF-VSZQJPAFSA-N |
| XLogP | 3.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|