C31H43ClFN3O — CID 143914764
N-[4-(3-chlorophenyl)-4-[5-[1-[[3-cyclohexyl-2-(methylamino)propyl]amino]ethenyl]-2-fluorophenyl]butyl]propanamide (PubChem CID 143914764) has the molecular formula C31H43ClFN3O and a molecular weight of 528.16 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-4-[5-[1-[[3-cyclohexyl-2-(methylamino)propyl]amino]ethenyl]-2-fluorophenyl]butyl]propanamide.
| Compound Name | N-[4-(3-chlorophenyl)-4-[5-[1-[[3-cyclohexyl-2-(methylamino)propyl]amino]ethenyl]-2-fluorophenyl]butyl]propanamide |
|---|---|
| PubChem CID | 143914764 |
| Molecular Formula | C31H43ClFN3O |
| Molecular Weight | 528.16 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | N-[4-(3-chlorophenyl)-4-[5-[1-[[3-cyclohexyl-2-(methylamino)propyl]amino]ethenyl]-2-fluorophenyl]butyl]propanamide |
| SMILES | C=C(NCC(CC1CCCCC1)NC)c1ccc(F)c(C(CCCNC(=O)CC)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C31H43ClFN3O/c1-4-31(37)35-17-9-14-28(25-12-8-13-26(32)19-25)29-20-24(15-16-30(29)33)22(2)36-21-27(34-3)18-23-10-6-5-7-11-23/h8,12-13,15-16,19-20,23,27-28,34,36H,2,4-7,9-11,14,17-18,21H2,1,3H3,(H,35,37) |
| InChIKey | UUJIPGOGBGYICO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.16 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|