C35H29N5O — CID 143925283
N'-[1-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-methyl-1-oxobut-3-en-2-yl]-N-(1-phenylethylidene)benzenecarboximidamide (PubChem CID 143925283) has the molecular formula C35H29N5O and a molecular weight of 535.65 g/mol. Its IUPAC name is N'-[1-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-methyl-1-oxobut-3-en-2-yl]-N-(1-phenylethylidene)benzenecarboximidamide.
| Compound Name | N'-[1-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-methyl-1-oxobut-3-en-2-yl]-N-(1-phenylethylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 143925283 |
| Molecular Formula | C35H29N5O |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | N'-[1-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-methyl-1-oxobut-3-en-2-yl]-N-(1-phenylethylidene)benzenecarboximidamide |
| SMILES | C=C(C)C(/N=C(\N=C(/C)c1ccccc1)c1ccccc1)C(=O)c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C35H29N5O/c1-24(2)30(37-32(27-18-10-5-11-19-27)36-25(3)26-16-8-4-9-17-26)31(41)35-39-33(28-20-12-6-13-21-28)38-34(40-35)29-22-14-7-15-23-29/h4-23,30H,1H2,2-3H3/b36-25+,37-32- |
| InChIKey | UAVUVACHTVEKTL-VXBLQTNQSA-N |
| XLogP | 7.29 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|