About 3-aminoprop-1-en-2-ol;ethane;4-methylphenol
3-aminoprop-1-en-2-ol;ethane;4-methylphenol (PubChem CID 143947102) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is 3-aminoprop-1-en-2-ol;ethane;4-methylphenol.
Molecular Properties
| Compound Name | 3-aminoprop-1-en-2-ol;ethane;4-methylphenol |
| PubChem CID | 143947102 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 3-aminoprop-1-en-2-ol;ethane;4-methylphenol |
| SMILES | C=C(O)CN.CC.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O.C3H7NO.C2H6/c1-6-2-4-7(8)5-3-6;1-3(5)2-4;1-2/h2-5,8H,1H3;5H,1-2,4H2;1-2H3 |
| InChIKey | ZPXRMGMZCKXKEW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-aminoprop-1-en-2-ol;ethane;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminoprop-1-en-2-ol;ethane;4-methylphenol?
The IUPAC name of 3-aminoprop-1-en-2-ol;ethane;4-methylphenol (CID 143947102) is 3-aminoprop-1-en-2-ol;ethane;4-methylphenol.
What is the SMILES notation for 3-aminoprop-1-en-2-ol;ethane;4-methylphenol?
The canonical SMILES for 3-aminoprop-1-en-2-ol;ethane;4-methylphenol is C=C(O)CN.CC.Cc1ccc(O)cc1.
What is the InChIKey of 3-aminoprop-1-en-2-ol;ethane;4-methylphenol?
The InChIKey is ZPXRMGMZCKXKEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C3H7NO.C2H6/c1-6-2-4-7(8)5-3-6;1-3(5)2-4;1-2/h2-5,8H,1H3;5H,1-2,4H2;1-2H3.
What are the key properties of 3-aminoprop-1-en-2-ol;ethane;4-methylphenol?
3-aminoprop-1-en-2-ol;ethane;4-methylphenol has a molecular weight of 211.30 g/mol, XLogP of 2.74, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminoprop-1-en-2-ol;ethane;4-methylphenol is sourced from PubChem (CID 143947102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).