C12H18N2O2 — CID 143973697
3-ethenyl-4,5-dimethoxy-2-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 143973697) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-ethenyl-4,5-dimethoxy-2-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 3-ethenyl-4,5-dimethoxy-2-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 143973697 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-ethenyl-4,5-dimethoxy-2-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | C=Cc1c(OC)c(OC)cc(N)c1N(C)C |
| InChI | InChI=1S/C12H18N2O2/c1-6-8-11(14(2)3)9(13)7-10(15-4)12(8)16-5/h6-7H,1,13H2,2-5H3 |
| InChIKey | BOQRSKHSYKRTAK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|