C13H21NO5S — CID 54074851
1-[4-(dimethylamino)-3,5-dimethoxyphenyl]-2-methylsulfonylethanol (PubChem CID 54074851) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-3,5-dimethoxyphenyl]-2-methylsulfonylethanol.
| Compound Name | 1-[4-(dimethylamino)-3,5-dimethoxyphenyl]-2-methylsulfonylethanol |
|---|---|
| PubChem CID | 54074851 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-[4-(dimethylamino)-3,5-dimethoxyphenyl]-2-methylsulfonylethanol |
| SMILES | COc1cc(C(O)CS(C)(=O)=O)cc(OC)c1N(C)C |
| InChI | InChI=1S/C13H21NO5S/c1-14(2)13-11(18-3)6-9(7-12(13)19-4)10(15)8-20(5,16)17/h6-7,10,15H,8H2,1-5H3 |
| InChIKey | MIYVYSWYNKLFBH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|