C11H17NO5S — CID 54306476
1-(4-amino-3,5-dimethoxyphenyl)-2-methylsulfonylethanol (PubChem CID 54306476) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-(4-amino-3,5-dimethoxyphenyl)-2-methylsulfonylethanol.
| Compound Name | 1-(4-amino-3,5-dimethoxyphenyl)-2-methylsulfonylethanol |
|---|---|
| PubChem CID | 54306476 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-(4-amino-3,5-dimethoxyphenyl)-2-methylsulfonylethanol |
| SMILES | COc1cc(C(O)CS(C)(=O)=O)cc(OC)c1N |
| InChI | InChI=1S/C11H17NO5S/c1-16-9-4-7(5-10(17-2)11(9)12)8(13)6-18(3,14)15/h4-5,8,13H,6,12H2,1-3H3 |
| InChIKey | SHWRZNLTHFHWJI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|