About 2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole
2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole (PubChem CID 143984574) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole.
Analyze 2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole?
The IUPAC name of 2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole (CID 143984574) is 2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole.
What is the SMILES notation for 2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole?
The canonical SMILES for 2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole is CC/C(C)=C\c1nc(C)oc1C.
What is the InChIKey of 2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole?
The InChIKey is IWGYBCLRIWXHFY-SREVYHEPSA-N. The full InChI is InChI=1S/C10H15NO/c1-5-7(2)6-10-8(3)12-9(4)11-10/h6H,5H2,1-4H3/b7-6-.
What are the key properties of 2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole?
2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole has a molecular weight of 165.24 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4-[(Z)-2-methylbut-1-enyl]-1,3-oxazole is sourced from PubChem (CID 143984574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).