C19H19ClN2O3S — CID 143984710
5-chloro-2-ethylsulfanyl-6-[2-(4-methoxycyclohexa-2,4-dien-1-yl)ethynyl]-1H-benzimidazole;formic acid (PubChem CID 143984710) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is 5-chloro-2-ethylsulfanyl-6-[2-(4-methoxycyclohexa-2,4-dien-1-yl)ethynyl]-1H-benzimidazole;formic acid.
| Compound Name | 5-chloro-2-ethylsulfanyl-6-[2-(4-methoxycyclohexa-2,4-dien-1-yl)ethynyl]-1H-benzimidazole;formic acid |
|---|---|
| PubChem CID | 143984710 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 5-chloro-2-ethylsulfanyl-6-[2-(4-methoxycyclohexa-2,4-dien-1-yl)ethynyl]-1H-benzimidazole;formic acid |
| SMILES | CCSc1nc2cc(Cl)c(C#CC3C=CC(OC)=CC3)cc2[nH]1.O=CO |
| InChI | InChI=1S/C18H17ClN2OS.CH2O2/c1-3-23-18-20-16-10-13(15(19)11-17(16)21-18)7-4-12-5-8-14(22-2)9-6-12;2-1-3/h5,8-12H,3,6H2,1-2H3,(H,20,21);1H,(H,2,3) |
| InChIKey | VSTQZUOIBZZIAX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|