C22H22Cl2N2O2 — CID 143985538
9-chloro-6-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole (PubChem CID 143985538) has the molecular formula C22H22Cl2N2O2 and a molecular weight of 417.34 g/mol. Its IUPAC name is 9-chloro-6-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole.
| Compound Name | 9-chloro-6-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole |
|---|---|
| PubChem CID | 143985538 |
| Molecular Formula | C22H22Cl2N2O2 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 9-chloro-6-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole |
| SMILES | Clc1ccc(C2(Cn3c4c(c5cc(Cl)ccc53)CCNCC4)OCCO2)cc1 |
| InChI | InChI=1S/C22H22Cl2N2O2/c23-16-3-1-15(2-4-16)22(27-11-12-28-22)14-26-20-6-5-17(24)13-19(20)18-7-9-25-10-8-21(18)26/h1-6,13,25H,7-12,14H2 |
| InChIKey | MPZUXGVXCPHUPX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 35.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|