About (2-methoxyphenyl)borinic acid
(2-methoxyphenyl)borinic acid (PubChem CID 143998271) has the molecular formula C7H9BO2
and a molecular weight of 135.96 g/mol. Its IUPAC name is (2-methoxyphenyl)borinic acid.
Molecular Properties
| Compound Name | (2-methoxyphenyl)borinic acid |
| PubChem CID | 143998271 |
| Molecular Formula | C7H9BO2 |
| Molecular Weight | 135.96 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | (2-methoxyphenyl)borinic acid |
| SMILES | COc1ccccc1BO |
| InChI | InChI=1S/C7H9BO2/c1-10-7-5-3-2-4-6(7)8-9/h2-5,8-9H,1H3 |
| InChIKey | SNAVEZIPLNGTTH-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.96 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxyphenyl)borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxyphenyl)borinic acid?
The IUPAC name of (2-methoxyphenyl)borinic acid (CID 143998271) is (2-methoxyphenyl)borinic acid.
What is the SMILES notation for (2-methoxyphenyl)borinic acid?
The canonical SMILES for (2-methoxyphenyl)borinic acid is COc1ccccc1BO.
What is the InChIKey of (2-methoxyphenyl)borinic acid?
The InChIKey is SNAVEZIPLNGTTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BO2/c1-10-7-5-3-2-4-6(7)8-9/h2-5,8-9H,1H3.
What are the key properties of (2-methoxyphenyl)borinic acid?
(2-methoxyphenyl)borinic acid has a molecular weight of 135.96 g/mol, XLogP of -0.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyphenyl)borinic acid is sourced from PubChem (CID 143998271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).