C26H42O4 — CID 144507860
ethane;2-[(4E,6Z)-4-ethenyl-2-methyl-3-oxoocta-4,6-dien-2-yl]oxyethyl (2E,3Z)-2-propylidenehexa-3,5-dienoate (PubChem CID 144507860) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is ethane;2-[(4E,6Z)-4-ethenyl-2-methyl-3-oxoocta-4,6-dien-2-yl]oxyethyl (2E,3Z)-2-propylidenehexa-3,5-dienoate.
| Compound Name | ethane;2-[(4E,6Z)-4-ethenyl-2-methyl-3-oxoocta-4,6-dien-2-yl]oxyethyl (2E,3Z)-2-propylidenehexa-3,5-dienoate |
|---|---|
| PubChem CID | 144507860 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | ethane;2-[(4E,6Z)-4-ethenyl-2-methyl-3-oxoocta-4,6-dien-2-yl]oxyethyl (2E,3Z)-2-propylidenehexa-3,5-dienoate |
| SMILES | C=C/C=C\C(=C/CC)C(=O)OCCOC(C)(C)C(=O)/C(C=C)=C/C=C\C.CC.CC |
| InChI | InChI=1S/C22H30O4.2C2H6/c1-7-11-14-18(10-4)20(23)22(5,6)26-17-16-25-21(24)19(13-9-3)15-12-8-2;2*1-2/h7-8,10-15H,2,4,9,16-17H2,1,3,5-6H3;2*1-2H3/b11-7-,15-12-,18-14+,19-13+;; |
| InChIKey | XYLVTLFIEIUTIA-ZCQDMAJZSA-N |
| XLogP | 6.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|