C27H46O4 — CID 144507862
ethane;1-[(4E,6Z)-2-methyl-3-oxo-4-[(Z)-prop-1-enyl]octa-4,6-dien-2-yl]oxypropan-2-yl (Z,2E)-2-ethylidenehex-3-enoate (PubChem CID 144507862) has the molecular formula C27H46O4 and a molecular weight of 434.66 g/mol. Its IUPAC name is ethane;1-[(4E,6Z)-2-methyl-3-oxo-4-[(Z)-prop-1-enyl]octa-4,6-dien-2-yl]oxypropan-2-yl (Z,2E)-2-ethylidenehex-3-enoate.
| Compound Name | ethane;1-[(4E,6Z)-2-methyl-3-oxo-4-[(Z)-prop-1-enyl]octa-4,6-dien-2-yl]oxypropan-2-yl (Z,2E)-2-ethylidenehex-3-enoate |
|---|---|
| PubChem CID | 144507862 |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | ethane;1-[(4E,6Z)-2-methyl-3-oxo-4-[(Z)-prop-1-enyl]octa-4,6-dien-2-yl]oxypropan-2-yl (Z,2E)-2-ethylidenehex-3-enoate |
| SMILES | C/C=C\C=C(/C=C\C)C(=O)C(C)(C)OCC(C)OC(=O)C(/C=C\CC)=C/C.CC.CC |
| InChI | InChI=1S/C23H34O4.2C2H6/c1-8-12-15-19(11-4)22(25)27-18(5)17-26-23(6,7)21(24)20(14-10-3)16-13-9-2;2*1-2/h9-16,18H,8,17H2,1-7H3;2*1-2H3/b13-9-,14-10-,15-12-,19-11+,20-16+;; |
| InChIKey | CPYRSXWYHUADFT-OAYLXHKCSA-N |
| XLogP | 7.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|