C25H28Cl2N2O3 — CID 144519639
2-[4-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-2-hydroxyphenyl]cyclopentene-1-carbaldehyde (PubChem CID 144519639) has the molecular formula C25H28Cl2N2O3 and a molecular weight of 475.42 g/mol. Its IUPAC name is 2-[4-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-2-hydroxyphenyl]cyclopentene-1-carbaldehyde.
| Compound Name | 2-[4-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-2-hydroxyphenyl]cyclopentene-1-carbaldehyde |
|---|---|
| PubChem CID | 144519639 |
| Molecular Formula | C25H28Cl2N2O3 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-[4-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-2-hydroxyphenyl]cyclopentene-1-carbaldehyde |
| SMILES | O=CC1=C(c2ccc(OCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2O)CCC1 |
| InChI | InChI=1S/C25H28Cl2N2O3/c26-22-6-2-7-23(25(22)27)29-13-11-28(12-14-29)10-3-15-32-19-8-9-21(24(31)16-19)20-5-1-4-18(20)17-30/h2,6-9,16-17,31H,1,3-5,10-15H2 |
| InChIKey | NSIACTLAMFLDBA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|