C23H22F4N8O — CID 144567196
ethane;5-fluoro-2-[(7H-purin-6-ylamino)methyl]-3H-quinazolin-4-one;3-(trifluoromethyl)aniline (PubChem CID 144567196) has the molecular formula C23H22F4N8O and a molecular weight of 502.48 g/mol. Its IUPAC name is ethane;5-fluoro-2-[(7H-purin-6-ylamino)methyl]-3H-quinazolin-4-one;3-(trifluoromethyl)aniline.
| Compound Name | ethane;5-fluoro-2-[(7H-purin-6-ylamino)methyl]-3H-quinazolin-4-one;3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 144567196 |
| Molecular Formula | C23H22F4N8O |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | ethane;5-fluoro-2-[(7H-purin-6-ylamino)methyl]-3H-quinazolin-4-one;3-(trifluoromethyl)aniline |
| SMILES | CC.Nc1cccc(C(F)(F)F)c1.O=c1[nH]c(CNc2ncnc3nc[nH]c23)nc2cccc(F)c12 |
| InChI | InChI=1S/C14H10FN7O.C7H6F3N.C2H6/c15-7-2-1-3-8-10(7)14(23)22-9(21-8)4-16-12-11-13(18-5-17-11)20-6-19-12;8-7(9,10)5-2-1-3-6(11)4-5;1-2/h1-3,5-6H,4H2,(H,21,22,23)(H2,16,17,18,19,20);1-4H,11H2;1-2H3 |
| InChIKey | UJQJYLUPSHJFIV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|