C20H30N2O4 — CID 144568018
methyl (E)-2-[(1-amino-3-cyclohepta-1,3,6-trien-1-yl-3-ethylhexylidene)amino]-3,4-dihydroxybut-2-enoate (PubChem CID 144568018) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl (E)-2-[(1-amino-3-cyclohepta-1,3,6-trien-1-yl-3-ethylhexylidene)amino]-3,4-dihydroxybut-2-enoate.
| Compound Name | methyl (E)-2-[(1-amino-3-cyclohepta-1,3,6-trien-1-yl-3-ethylhexylidene)amino]-3,4-dihydroxybut-2-enoate |
|---|---|
| PubChem CID | 144568018 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | methyl (E)-2-[(1-amino-3-cyclohepta-1,3,6-trien-1-yl-3-ethylhexylidene)amino]-3,4-dihydroxybut-2-enoate |
| SMILES | CCCC(CC)(C/C(N)=N\C(C(=O)OC)=C(\O)CO)C1=CC=CCC=C1 |
| InChI | InChI=1S/C20H30N2O4/c1-4-12-20(5-2,15-10-8-6-7-9-11-15)13-17(21)22-18(16(24)14-23)19(25)26-3/h6,8-11,23-24H,4-5,7,12-14H2,1-3H3,(H2,21,22)/b18-16+ |
| InChIKey | BFMGNPCUGQVRTH-FBMGVBCBSA-N |
| XLogP | 3.31 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|