C20H15BrF3N3O2 — CID 144601865
3-(benzylamino)-5-bromo-4-methanimidoyl-1-[4-(trifluoromethoxy)phenyl]pyridin-2-one (PubChem CID 144601865) has the molecular formula C20H15BrF3N3O2 and a molecular weight of 466.26 g/mol. Its IUPAC name is 3-(benzylamino)-5-bromo-4-methanimidoyl-1-[4-(trifluoromethoxy)phenyl]pyridin-2-one.
| Compound Name | 3-(benzylamino)-5-bromo-4-methanimidoyl-1-[4-(trifluoromethoxy)phenyl]pyridin-2-one |
|---|---|
| PubChem CID | 144601865 |
| Molecular Formula | C20H15BrF3N3O2 |
| Molecular Weight | 466.26 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 3-(benzylamino)-5-bromo-4-methanimidoyl-1-[4-(trifluoromethoxy)phenyl]pyridin-2-one |
| SMILES | [H]/N=C/c1c(Br)cn(-c2ccc(OC(F)(F)F)cc2)c(=O)c1NCc1ccccc1 |
| InChI | InChI=1S/C20H15BrF3N3O2/c21-17-12-27(14-6-8-15(9-7-14)29-20(22,23)24)19(28)18(16(17)10-25)26-11-13-4-2-1-3-5-13/h1-10,12,25-26H,11H2/b25-10+ |
| InChIKey | AANLUJTXPPMZMD-KIBLKLHPSA-N |
| XLogP | 5.11 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.26 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|