About 2,7-dimethylisoquinolin-2-ium;ethane
2,7-dimethylisoquinolin-2-ium;ethane (PubChem CID 144617813) has the molecular formula C15H24N+
and a molecular weight of 218.36 g/mol. Its IUPAC name is 2,7-dimethylisoquinolin-2-ium;ethane.
Molecular Properties
| Compound Name | 2,7-dimethylisoquinolin-2-ium;ethane |
| PubChem CID | 144617813 |
| Molecular Formula | C15H24N+ |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 2,7-dimethylisoquinolin-2-ium;ethane |
| SMILES | CC.CC.Cc1ccc2cc[n+](C)cc2c1 |
| InChI | InChI=1S/C11H12N.2C2H6/c1-9-3-4-10-5-6-12(2)8-11(10)7-9;2*1-2/h3-8H,1-2H3;2*1-2H3/q+1;; |
| InChIKey | XDLVFOROJUGKDJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dimethylisoquinolin-2-ium;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylisoquinolin-2-ium;ethane?
The IUPAC name of 2,7-dimethylisoquinolin-2-ium;ethane (CID 144617813) is 2,7-dimethylisoquinolin-2-ium;ethane.
What is the SMILES notation for 2,7-dimethylisoquinolin-2-ium;ethane?
The canonical SMILES for 2,7-dimethylisoquinolin-2-ium;ethane is CC.CC.Cc1ccc2cc[n+](C)cc2c1.
What is the InChIKey of 2,7-dimethylisoquinolin-2-ium;ethane?
The InChIKey is XDLVFOROJUGKDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N.2C2H6/c1-9-3-4-10-5-6-12(2)8-11(10)7-9;2*1-2/h3-8H,1-2H3;2*1-2H3/q+1;;.
What are the key properties of 2,7-dimethylisoquinolin-2-ium;ethane?
2,7-dimethylisoquinolin-2-ium;ethane has a molecular weight of 218.36 g/mol, XLogP of 4.03, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylisoquinolin-2-ium;ethane is sourced from PubChem (CID 144617813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).