C9H10NTe+ — CID 88517133
2,5-dimethyl-1,2-benzotellurazol-2-ium (PubChem CID 88517133) has the molecular formula C9H10NTe+ and a molecular weight of 259.79 g/mol. Its IUPAC name is 2,5-dimethyl-1,2-benzotellurazol-2-ium.
| Compound Name | 2,5-dimethyl-1,2-benzotellurazol-2-ium |
|---|---|
| PubChem CID | 88517133 |
| Molecular Formula | C9H10NTe+ |
| Molecular Weight | 259.79 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 2,5-dimethyl-1,2-benzotellurazol-2-ium |
| SMILES | Cc1ccc2[te][n+](C)cc2c1 |
| InChI | InChI=1S/C9H10NTe/c1-7-3-4-9-8(5-7)6-10(2)11-9/h3-6H,1-2H3/q+1 |
| InChIKey | ZKOQNNHLJZQAQK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.79 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|