C25H41NO4 — CID 144618273
(Z)-N-[(1E,3E)-1-(1,6-dioxaspiro[2.5]octan-5-yl)-3,7-dimethylundeca-1,3-dien-6-yl]oxy-4-methylpent-2-enamide (PubChem CID 144618273) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is (Z)-N-[(1E,3E)-1-(1,6-dioxaspiro[2.5]octan-5-yl)-3,7-dimethylundeca-1,3-dien-6-yl]oxy-4-methylpent-2-enamide.
| Compound Name | (Z)-N-[(1E,3E)-1-(1,6-dioxaspiro[2.5]octan-5-yl)-3,7-dimethylundeca-1,3-dien-6-yl]oxy-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 144618273 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | (Z)-N-[(1E,3E)-1-(1,6-dioxaspiro[2.5]octan-5-yl)-3,7-dimethylundeca-1,3-dien-6-yl]oxy-4-methylpent-2-enamide |
| SMILES | CCCCC(C)C(C/C=C(C)/C=C/C1CC2(CCO1)CO2)ONC(=O)/C=C\C(C)C |
| InChI | InChI=1S/C25H41NO4/c1-6-7-8-21(5)23(30-26-24(27)14-9-19(2)3)13-11-20(4)10-12-22-17-25(18-29-25)15-16-28-22/h9-12,14,19,21-23H,6-8,13,15-18H2,1-5H3,(H,26,27)/b12-10+,14-9-,20-11+ |
| InChIKey | FVGKFOFMSCQKGW-KQWVOTKWSA-N |
| XLogP | 5.28 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|