C28H43NO7 — CID 173063160
[5-[[2-[5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] 2,2-dimethylpropanoate (PubChem CID 173063160) has the molecular formula C28H43NO7 and a molecular weight of 505.65 g/mol. Its IUPAC name is [5-[[2-[5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [5-[[2-[5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 173063160 |
| Molecular Formula | C28H43NO7 |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | [5-[[2-[5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C=C[C@@H]1C[C@]2(CO2)CC(C)(C)O1)=CCC1OCC(NC(=O)C=CC(C)OC(=O)C(C)(C)C)CO1 |
| InChI | InChI=1S/C28H43NO7/c1-19(8-11-22-14-28(18-34-28)17-27(6,7)36-22)9-13-24-32-15-21(16-33-24)29-23(30)12-10-20(2)35-25(31)26(3,4)5/h8-12,20-22,24H,13-18H2,1-7H3,(H,29,30)/t20?,21?,22-,24?,28-/m1/s1 |
| InChIKey | GPKKDOHNMUZCJO-BGAOFFLLSA-N |
| XLogP | 4.00 |
| TPSA | 95.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|