C32H51N3O6 — CID 173063147
[5-[[4-[5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] 4-(2-hydroxyethyl)piperazine-1-carboxylate (PubChem CID 173063147) has the molecular formula C32H51N3O6 and a molecular weight of 573.78 g/mol. Its IUPAC name is [5-[[4-[5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] 4-(2-hydroxyethyl)piperazine-1-carboxylate.
| Compound Name | [5-[[4-[5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] 4-(2-hydroxyethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 173063147 |
| Molecular Formula | C32H51N3O6 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.38 |
| IUPAC Name | [5-[[4-[5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] 4-(2-hydroxyethyl)piperazine-1-carboxylate |
| SMILES | CC(C=C[C@@H]1C[C@]2(CO2)CC(C)(C)O1)=CCC1CCC(NC(=O)C=CC(C)OC(=O)N2CCN(CCO)CC2)CC1 |
| InChI | InChI=1S/C32H51N3O6/c1-24(6-13-28-21-32(23-39-32)22-31(3,4)41-28)5-8-26-9-11-27(12-10-26)33-29(37)14-7-25(2)40-30(38)35-17-15-34(16-18-35)19-20-36/h5-7,13-14,25-28,36H,8-12,15-23H2,1-4H3,(H,33,37)/t25?,26?,27?,28-,32-/m1/s1 |
| InChIKey | WXEJWIYFXLOJFQ-BFXTVXQBSA-N |
| XLogP | 3.97 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|