C25H40N2O7 — CID 144642364
[(Z,2S)-5-[[2-[(2E,4E)-5-[(2S,4S)-4-(hydroxymethyl)-6,6-dimethyloxan-2-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N-methylcarbamate (PubChem CID 144642364) has the molecular formula C25H40N2O7 and a molecular weight of 480.60 g/mol. Its IUPAC name is [(Z,2S)-5-[[2-[(2E,4E)-5-[(2S,4S)-4-(hydroxymethyl)-6,6-dimethyloxan-2-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N-methylcarbamate.
| Compound Name | [(Z,2S)-5-[[2-[(2E,4E)-5-[(2S,4S)-4-(hydroxymethyl)-6,6-dimethyloxan-2-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 144642364 |
| Molecular Formula | C25H40N2O7 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | [(Z,2S)-5-[[2-[(2E,4E)-5-[(2S,4S)-4-(hydroxymethyl)-6,6-dimethyloxan-2-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N-methylcarbamate |
| SMILES | CNC(=O)O[C@@H](C)/C=C\C(=O)NC1COC(C/C=C(C)/C=C/[C@@H]2C[C@H](CO)CC(C)(C)O2)OC1 |
| InChI | InChI=1S/C25H40N2O7/c1-17(6-9-21-12-19(14-28)13-25(3,4)34-21)7-11-23-31-15-20(16-32-23)27-22(29)10-8-18(2)33-24(30)26-5/h6-10,18-21,23,28H,11-16H2,1-5H3,(H,26,30)(H,27,29)/b9-6+,10-8-,17-7+/t18-,19-,20?,21+,23?/m0/s1 |
| InChIKey | DEGRQDYOUGQODM-VOHLEQHBSA-N |
| XLogP | 2.60 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|