C28H44N2O4 — CID 76685131
[(Z,2S)-5-[[4-[(2E,4E)-5-[(5S)-7,7-dimethyl-6-oxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] N-methylcarbamate (PubChem CID 76685131) has the molecular formula C28H44N2O4 and a molecular weight of 472.67 g/mol. Its IUPAC name is [(Z,2S)-5-[[4-[(2E,4E)-5-[(5S)-7,7-dimethyl-6-oxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] N-methylcarbamate.
| Compound Name | [(Z,2S)-5-[[4-[(2E,4E)-5-[(5S)-7,7-dimethyl-6-oxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 76685131 |
| Molecular Formula | C28H44N2O4 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | [(Z,2S)-5-[[4-[(2E,4E)-5-[(5S)-7,7-dimethyl-6-oxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] N-methylcarbamate |
| SMILES | CNC(=O)O[C@@H](C)/C=C\C(=O)NC1CCC(C/C=C(C)/C=C/[C@@H]2CC3(CC3)CC(C)(C)O2)CC1 |
| InChI | InChI=1S/C28H44N2O4/c1-20(7-14-24-18-28(16-17-28)19-27(3,4)34-24)6-9-22-10-12-23(13-11-22)30-25(31)15-8-21(2)33-26(32)29-5/h6-8,14-15,21-24H,9-13,16-19H2,1-5H3,(H,29,32)(H,30,31)/b14-7+,15-8-,20-6+/t21-,22?,23?,24+/m0/s1 |
| InChIKey | QMDPTIPHYLOXNQ-FQEXZXKOSA-N |
| XLogP | 5.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|