C26H43N3O6 — CID 144642321
[(Z,2S)-5-[[2-[(2E,4E)-5-[(2S,4R)-4-amino-4,6,6-trimethyloxan-2-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N,N-dimethylcarbamate (PubChem CID 144642321) has the molecular formula C26H43N3O6 and a molecular weight of 493.65 g/mol. Its IUPAC name is [(Z,2S)-5-[[2-[(2E,4E)-5-[(2S,4R)-4-amino-4,6,6-trimethyloxan-2-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(Z,2S)-5-[[2-[(2E,4E)-5-[(2S,4R)-4-amino-4,6,6-trimethyloxan-2-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 144642321 |
| Molecular Formula | C26H43N3O6 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | [(Z,2S)-5-[[2-[(2E,4E)-5-[(2S,4R)-4-amino-4,6,6-trimethyloxan-2-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CC(/C=C/[C@@H]1C[C@@](C)(N)CC(C)(C)O1)=C\CC1OCC(NC(=O)/C=C\[C@H](C)OC(=O)N(C)C)CO1 |
| InChI | InChI=1S/C26H43N3O6/c1-18(8-11-21-14-26(5,27)17-25(3,4)35-21)9-13-23-32-15-20(16-33-23)28-22(30)12-10-19(2)34-24(31)29(6)7/h8-12,19-21,23H,13-17,27H2,1-7H3,(H,28,30)/b11-8+,12-10-,18-9+/t19-,20?,21+,23?,26+/m0/s1 |
| InChIKey | JDGNMIATGSITEU-DARZFNMGSA-N |
| XLogP | 3.05 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|