C28H42N2O7 — CID 144642320
[(Z,2S)-5-[[2-[(2E)-5-[(3S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-ylidene]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N,N-diethylcarbamate (PubChem CID 144642320) has the molecular formula C28H42N2O7 and a molecular weight of 518.65 g/mol. Its IUPAC name is [(Z,2S)-5-[[2-[(2E)-5-[(3S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-ylidene]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N,N-diethylcarbamate.
| Compound Name | [(Z,2S)-5-[[2-[(2E)-5-[(3S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-ylidene]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 144642320 |
| Molecular Formula | C28H42N2O7 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | [(Z,2S)-5-[[2-[(2E)-5-[(3S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-ylidene]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O[C@@H](C)/C=C\C(=O)NC1COC(C/C=C(\C)C=C=C2C[C@]3(CO3)CC(C)(C)O2)OC1 |
| InChI | InChI=1S/C28H42N2O7/c1-7-30(8-2)26(32)36-21(4)11-13-24(31)29-22-16-33-25(34-17-22)14-10-20(3)9-12-23-15-28(19-35-28)18-27(5,6)37-23/h9-11,13,21-22,25H,7-8,14-19H2,1-6H3,(H,29,31)/b13-11-,20-10+/t12?,21-,22?,25?,28+/m0/s1 |
| InChIKey | XGAALDCUAUYAHX-NREVVNGTSA-N |
| XLogP | 4.00 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|