C27H44N2O5 — CID 123972520
N-[4-[5-(5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl)-3-methylpenta-2,4-dienyl]cyclohexyl]-4-[hydroxy(methylamino)methoxy]pent-2-enamide (PubChem CID 123972520) has the molecular formula C27H44N2O5 and a molecular weight of 476.66 g/mol. Its IUPAC name is N-[4-[5-(5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl)-3-methylpenta-2,4-dienyl]cyclohexyl]-4-[hydroxy(methylamino)methoxy]pent-2-enamide.
| Compound Name | N-[4-[5-(5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl)-3-methylpenta-2,4-dienyl]cyclohexyl]-4-[hydroxy(methylamino)methoxy]pent-2-enamide |
|---|---|
| PubChem CID | 123972520 |
| Molecular Formula | C27H44N2O5 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | N-[4-[5-(5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl)-3-methylpenta-2,4-dienyl]cyclohexyl]-4-[hydroxy(methylamino)methoxy]pent-2-enamide |
| SMILES | CNC(O)OC(C)C=CC(=O)NC1CCC(CC=C(C)C=CC2CC3(CO3)CC(C)(C)O2)CC1 |
| InChI | InChI=1S/C27H44N2O5/c1-19(7-14-23-16-27(18-32-27)17-26(3,4)34-23)6-9-21-10-12-22(13-11-21)29-24(30)15-8-20(2)33-25(31)28-5/h6-8,14-15,20-23,25,28,31H,9-13,16-18H2,1-5H3,(H,29,30) |
| InChIKey | RZWMHDPSCMFXOM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|