C18H28O3 — CID 144618458
5-[(1E,3E)-3-methyl-5-(3-methyloxan-2-yl)penta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane (PubChem CID 144618458) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 5-[(1E,3E)-3-methyl-5-(3-methyloxan-2-yl)penta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane.
| Compound Name | 5-[(1E,3E)-3-methyl-5-(3-methyloxan-2-yl)penta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 144618458 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 5-[(1E,3E)-3-methyl-5-(3-methyloxan-2-yl)penta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane |
| SMILES | CC(/C=C/C1CC2(CCO1)CO2)=C\CC1OCCCC1C |
| InChI | InChI=1S/C18H28O3/c1-14(6-8-17-15(2)4-3-10-20-17)5-7-16-12-18(13-21-18)9-11-19-16/h5-7,15-17H,3-4,8-13H2,1-2H3/b7-5+,14-6+ |
| InChIKey | QNOUVDKZAXWSKR-AVWMDXPNSA-N |
| XLogP | 3.64 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|