C29H38O3S — CID 144627691
(3E,5E,7E,9Z)-7-ethenyl-3,6-dimethylundeca-3,5,7,9-tetraen-2-one;1-ethylnaphthalene;methylsulfonylmethane (PubChem CID 144627691) has the molecular formula C29H38O3S and a molecular weight of 466.69 g/mol. Its IUPAC name is (3E,5E,7E,9Z)-7-ethenyl-3,6-dimethylundeca-3,5,7,9-tetraen-2-one;1-ethylnaphthalene;methylsulfonylmethane.
| Compound Name | (3E,5E,7E,9Z)-7-ethenyl-3,6-dimethylundeca-3,5,7,9-tetraen-2-one;1-ethylnaphthalene;methylsulfonylmethane |
|---|---|
| PubChem CID | 144627691 |
| Molecular Formula | C29H38O3S |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (3E,5E,7E,9Z)-7-ethenyl-3,6-dimethylundeca-3,5,7,9-tetraen-2-one;1-ethylnaphthalene;methylsulfonylmethane |
| SMILES | C=CC(=C\C=C/C)/C(C)=C/C=C(\C)C(C)=O.CCc1cccc2ccccc12.CS(C)(=O)=O |
| InChI | InChI=1S/C15H20O.C12H12.C2H6O2S/c1-6-8-9-15(7-2)13(4)11-10-12(3)14(5)16;1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-5(2,3)4/h6-11H,2H2,1,3-5H3;3-9H,2H2,1H3;1-2H3/b8-6-,12-10+,13-11+,15-9+;; |
| InChIKey | NARNAMBHUBDHAB-RODIFWNGSA-N |
| XLogP | 7.22 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|