C22H27F3N4O4 — CID 144642543
tert-butyl 3-methyl-3-[(1S)-1-[2-oxo-8-(trifluoromethyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]ethyl]azetidine-1-carboxylate (PubChem CID 144642543) has the molecular formula C22H27F3N4O4 and a molecular weight of 468.48 g/mol. Its IUPAC name is tert-butyl 3-methyl-3-[(1S)-1-[2-oxo-8-(trifluoromethyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]ethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-3-[(1S)-1-[2-oxo-8-(trifluoromethyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]ethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 144642543 |
| Molecular Formula | C22H27F3N4O4 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | tert-butyl 3-methyl-3-[(1S)-1-[2-oxo-8-(trifluoromethyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]ethyl]azetidine-1-carboxylate |
| SMILES | C[C@@H](c1cc2c(cc1C(F)(F)F)OCC1=NNC(=O)CN12)C1(C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H27F3N4O4/c1-12(21(5)10-28(11-21)19(31)33-20(2,3)4)13-6-15-16(7-14(13)22(23,24)25)32-9-17-26-27-18(30)8-29(15)17/h6-7,12H,8-11H2,1-5H3,(H,27,30)/t12-/m0/s1 |
| InChIKey | UXTHQXHBPQIJNG-LBPRGKRZSA-N |
| XLogP | 3.71 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |