C32H32S2 — CID 144644905
3-[(3E,5Z)-3-ethylhepta-1,3,5-trien-2-yl]-8-methyl-2-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]-5-phenyl-1,4-benzodithiine (PubChem CID 144644905) has the molecular formula C32H32S2 and a molecular weight of 480.74 g/mol. Its IUPAC name is 3-[(3E,5Z)-3-ethylhepta-1,3,5-trien-2-yl]-8-methyl-2-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]-5-phenyl-1,4-benzodithiine.
| Compound Name | 3-[(3E,5Z)-3-ethylhepta-1,3,5-trien-2-yl]-8-methyl-2-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]-5-phenyl-1,4-benzodithiine |
|---|---|
| PubChem CID | 144644905 |
| Molecular Formula | C32H32S2 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 3-[(3E,5Z)-3-ethylhepta-1,3,5-trien-2-yl]-8-methyl-2-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]-5-phenyl-1,4-benzodithiine |
| SMILES | C=C/C=C\C(=C)C(=C)C1=C(C(=C)/C(=C/C=C\C)CC)Sc2c(-c3ccccc3)ccc(C)c2S1 |
| InChI | InChI=1S/C32H32S2/c1-8-11-16-22(4)24(6)30-31(25(7)26(10-3)17-12-9-2)34-32-28(27-18-14-13-15-19-27)21-20-23(5)29(32)33-30/h8-9,11-21H,1,4,6-7,10H2,2-3,5H3/b12-9-,16-11-,26-17+ |
| InChIKey | HCVYRUVNQUZVRQ-OQXFYHRJSA-N |
| XLogP | 10.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|