C44H48 — CID 143743058
ethane;(1Z,2Z)-1-ethylidene-2-[(2Z,4E,9Z)-5-methyl-8-methylidenedodeca-2,4,9,11-tetraen-6-ylidene]-5,6-diphenylacenaphthylene (PubChem CID 143743058) has the molecular formula C44H48 and a molecular weight of 576.87 g/mol. Its IUPAC name is ethane;(1Z,2Z)-1-ethylidene-2-[(2Z,4E,9Z)-5-methyl-8-methylidenedodeca-2,4,9,11-tetraen-6-ylidene]-5,6-diphenylacenaphthylene.
| Compound Name | ethane;(1Z,2Z)-1-ethylidene-2-[(2Z,4E,9Z)-5-methyl-8-methylidenedodeca-2,4,9,11-tetraen-6-ylidene]-5,6-diphenylacenaphthylene |
|---|---|
| PubChem CID | 143743058 |
| Molecular Formula | C44H48 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | ethane;(1Z,2Z)-1-ethylidene-2-[(2Z,4E,9Z)-5-methyl-8-methylidenedodeca-2,4,9,11-tetraen-6-ylidene]-5,6-diphenylacenaphthylene |
| SMILES | C=C/C=C\C(=C)CC(=C1C(=C/C)\c2ccc(-c3ccccc3)c3c(-c4ccccc4)ccc\1c23)/C(C)=C/C=C\C.CC.CC |
| InChI | InChI=1S/C40H36.2C2H6/c1-6-9-17-28(4)27-37(29(5)18-10-7-2)38-32(8-3)35-25-23-33(30-19-13-11-14-20-30)39-34(24-26-36(38)40(35)39)31-21-15-12-16-22-31;2*1-2/h6-26H,1,4,27H2,2-3,5H3;2*1-2H3/b10-7-,17-9-,29-18+,32-8-,38-37-;; |
| InChIKey | YOJFPUOVJMCRQD-VKUYCICDSA-N |
| XLogP | 13.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|