C30H31N — CID 144660610
N-[(3Z,5E,6E)-5-ethylidene-6-methyldodeca-1,3,6,9-tetraen-2-yl]-N-methyl-7,8-didehydrophenanthren-9-amine (PubChem CID 144660610) has the molecular formula C30H31N and a molecular weight of 405.59 g/mol. Its IUPAC name is N-[(3Z,5E,6E)-5-ethylidene-6-methyldodeca-1,3,6,9-tetraen-2-yl]-N-methyl-7,8-didehydrophenanthren-9-amine.
| Compound Name | N-[(3Z,5E,6E)-5-ethylidene-6-methyldodeca-1,3,6,9-tetraen-2-yl]-N-methyl-7,8-didehydrophenanthren-9-amine |
|---|---|
| PubChem CID | 144660610 |
| Molecular Formula | C30H31N |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | N-[(3Z,5E,6E)-5-ethylidene-6-methyldodeca-1,3,6,9-tetraen-2-yl]-N-methyl-7,8-didehydrophenanthren-9-amine |
| SMILES | C=C(/C=C\C(=C/C)\C(C)=C\CC=CCC)N(C)c1cc2ccccc2c2ccc#cc12 |
| InChI | InChI=1S/C30H31N/c1-6-8-9-10-15-23(3)25(7-2)21-20-24(4)31(5)30-22-26-16-11-12-17-27(26)28-18-13-14-19-29(28)30/h7-9,11-13,15-18,20-22H,4,6,10H2,1-3,5H3/b9-8?,21-20-,23-15+,25-7+ |
| InChIKey | LKPRTIZJEZIRKW-SATVREGNSA-N |
| XLogP | 8.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|