C24H27I — CID 143060316
(2Z,3Z)-2-ethylidene-3-[(3E,6E,8Z)-3-methyl-2-methylidenedeca-3,6,8-trienylidene]naphthalene;hydroiodide (PubChem CID 143060316) has the molecular formula C24H27I and a molecular weight of 442.38 g/mol. Its IUPAC name is (2Z,3Z)-2-ethylidene-3-[(3E,6E,8Z)-3-methyl-2-methylidenedeca-3,6,8-trienylidene]naphthalene;hydroiodide.
| Compound Name | (2Z,3Z)-2-ethylidene-3-[(3E,6E,8Z)-3-methyl-2-methylidenedeca-3,6,8-trienylidene]naphthalene;hydroiodide |
|---|---|
| PubChem CID | 143060316 |
| Molecular Formula | C24H27I |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | (2Z,3Z)-2-ethylidene-3-[(3E,6E,8Z)-3-methyl-2-methylidenedeca-3,6,8-trienylidene]naphthalene;hydroiodide |
| SMILES | C=C(/C=c1/cc2ccccc2c/c1=C/C)/C(C)=C/C/C=C/C=C\C.I |
| InChI | InChI=1S/C24H26.HI/c1-5-7-8-9-10-13-19(3)20(4)16-24-18-23-15-12-11-14-22(23)17-21(24)6-2;/h5-9,11-18H,4,10H2,1-3H3;1H/b7-5-,9-8+,19-13+,21-6-,24-16-; |
| InChIKey | DEFSXCDSDQFQHG-UMIWJGQSSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|