C29H42N8O3 — CID 144677984
(Z)-[[8-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-(6-methylspiro[2.5]octan-2-yl)purin-2-yl]-aminomethylidene]carbamic acid (PubChem CID 144677984) has the molecular formula C29H42N8O3 and a molecular weight of 550.71 g/mol. Its IUPAC name is (Z)-[[8-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-(6-methylspiro[2.5]octan-2-yl)purin-2-yl]-aminomethylidene]carbamic acid.
| Compound Name | (Z)-[[8-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-(6-methylspiro[2.5]octan-2-yl)purin-2-yl]-aminomethylidene]carbamic acid |
|---|---|
| PubChem CID | 144677984 |
| Molecular Formula | C29H42N8O3 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.34 |
| IUPAC Name | (Z)-[[8-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-(6-methylspiro[2.5]octan-2-yl)purin-2-yl]-aminomethylidene]carbamic acid |
| SMILES | CC1CCC2(CC1)CC2n1c(N2CCOC3CCCC32)nc2nc(/C(N)=N/C(=O)O)nc(N[C@H](C)C3CCC3)c21 |
| InChI | InChI=1S/C29H42N8O3/c1-16-9-11-29(12-10-16)15-21(29)37-22-24(31-17(2)18-5-3-6-18)33-26(23(30)32-28(38)39)34-25(22)35-27(37)36-13-14-40-20-8-4-7-19(20)36/h16-21H,3-15H2,1-2H3,(H2,30,32)(H,38,39)(H,31,33,34)/t16?,17-,19?,20?,21?,29?/m1/s1 |
| InChIKey | OKWDINMKKGHIOA-APCCVWLISA-N |
| XLogP | 4.71 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|