C17H24N2 — CID 144707439
(E,3Z)-6-[(Z)-but-2-en-2-yl]imino-5-ethenyl-3-ethylidenenon-4-enenitrile (PubChem CID 144707439) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (E,3Z)-6-[(Z)-but-2-en-2-yl]imino-5-ethenyl-3-ethylidenenon-4-enenitrile.
| Compound Name | (E,3Z)-6-[(Z)-but-2-en-2-yl]imino-5-ethenyl-3-ethylidenenon-4-enenitrile |
|---|---|
| PubChem CID | 144707439 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (E,3Z)-6-[(Z)-but-2-en-2-yl]imino-5-ethenyl-3-ethylidenenon-4-enenitrile |
| SMILES | C=CC(=C\C(=C/C)CC#N)/C(CCC)=N\C(C)=C/C |
| InChI | InChI=1S/C17H24N2/c1-6-10-17(19-14(5)7-2)16(9-4)13-15(8-3)11-12-18/h7-9,13H,4,6,10-11H2,1-3,5H3/b14-7-,15-8-,16-13+,19-17+ |
| InChIKey | RDLMZFGIDIXFQK-SWYCFOLUSA-N |
| XLogP | 5.12 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|